C15H17BrFN3 — CID 66424292
2-(3-bromo-5-fluorophenyl)-6-tert-butyl-N-methylpyrimidin-4-amine (PubChem CID 66424292) has the molecular formula C15H17BrFN3 and a molecular weight of 338.22 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenyl)-6-tert-butyl-N-methylpyrimidin-4-amine.
| Compound Name | 2-(3-bromo-5-fluorophenyl)-6-tert-butyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66424292 |
| Molecular Formula | C15H17BrFN3 |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 2-(3-bromo-5-fluorophenyl)-6-tert-butyl-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(C(C)(C)C)nc(-c2cc(F)cc(Br)c2)n1 |
| InChI | InChI=1S/C15H17BrFN3/c1-15(2,3)12-8-13(18-4)20-14(19-12)9-5-10(16)7-11(17)6-9/h5-8H,1-4H3,(H,18,19,20) |
| InChIKey | GRSXCKKQAAVYGT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |