C13H14BrFN2O3 — CID 66424308
3-(3-bromo-5-fluorophenyl)-5-(diethoxymethyl)-1,2,4-oxadiazole (PubChem CID 66424308) has the molecular formula C13H14BrFN2O3 and a molecular weight of 345.17 g/mol. Its IUPAC name is 3-(3-bromo-5-fluorophenyl)-5-(diethoxymethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(3-bromo-5-fluorophenyl)-5-(diethoxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 66424308 |
| Molecular Formula | C13H14BrFN2O3 |
| Molecular Weight | 345.17 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 3-(3-bromo-5-fluorophenyl)-5-(diethoxymethyl)-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(-c2cc(F)cc(Br)c2)no1 |
| InChI | InChI=1S/C13H14BrFN2O3/c1-3-18-13(19-4-2)12-16-11(17-20-12)8-5-9(14)7-10(15)6-8/h5-7,13H,3-4H2,1-2H3 |
| InChIKey | SXMZKVLZFBEPRB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.17 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|