About 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide
3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide (PubChem CID 66424777) has the molecular formula C9H12ClN3O3
and a molecular weight of 245.67 g/mol. Its IUPAC name is 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide |
| PubChem CID | 66424777 |
| Molecular Formula | C9H12ClN3O3 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCn1cc(Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12ClN3O3/c1-12(2)7(14)3-4-13-5-6(10)8(15)11-9(13)16/h5H,3-4H2,1-2H3,(H,11,15,16) |
| InChIKey | SWAYMQSIJJLEOF-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide?
The IUPAC name of 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide (CID 66424777) is 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide.
What is the SMILES notation for 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide?
The canonical SMILES for 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide is CN(C)C(=O)CCn1cc(Cl)c(=O)[nH]c1=O.
What is the InChIKey of 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide?
The InChIKey is SWAYMQSIJJLEOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN3O3/c1-12(2)7(14)3-4-13-5-6(10)8(15)11-9(13)16/h5H,3-4H2,1-2H3,(H,11,15,16).
What are the key properties of 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide?
3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide has a molecular weight of 245.67 g/mol, XLogP of -0.33, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N,N-dimethylpropanamide is sourced from PubChem (CID 66424777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).