About 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione
5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione (PubChem CID 66425177) has the molecular formula C12H15ClN4O2
and a molecular weight of 282.73 g/mol. Its IUPAC name is 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione |
| PubChem CID | 66425177 |
| Molecular Formula | C12H15ClN4O2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione |
| SMILES | CCc1cc(Cn2cc(Cl)c(=O)[nH]c2=O)n(CC)n1 |
| InChI | InChI=1S/C12H15ClN4O2/c1-3-8-5-9(17(4-2)15-8)6-16-7-10(13)11(18)14-12(16)19/h5,7H,3-4,6H2,1-2H3,(H,14,18,19) |
| InChIKey | WWHIHKWVBGOEHF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione?
The IUPAC name of 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione (CID 66425177) is 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione.
What is the SMILES notation for 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione?
The canonical SMILES for 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione is CCc1cc(Cn2cc(Cl)c(=O)[nH]c2=O)n(CC)n1.
What is the InChIKey of 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione?
The InChIKey is WWHIHKWVBGOEHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN4O2/c1-3-8-5-9(17(4-2)15-8)6-16-7-10(13)11(18)14-12(16)19/h5,7H,3-4,6H2,1-2H3,(H,14,18,19).
What are the key properties of 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione?
5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione has a molecular weight of 282.73 g/mol, XLogP of 1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-[(1,3-diethylpyrazol-5-yl)methyl]pyrimidine-2,4-dione is sourced from PubChem (CID 66425177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).