C14H21N3O — CID 66427347
4-amino-3-(3,4-dihydro-2H-quinolin-1-yl)-N-methylbutanamide (PubChem CID 66427347) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 4-amino-3-(3,4-dihydro-2H-quinolin-1-yl)-N-methylbutanamide.
| Compound Name | 4-amino-3-(3,4-dihydro-2H-quinolin-1-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 66427347 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 4-amino-3-(3,4-dihydro-2H-quinolin-1-yl)-N-methylbutanamide |
| SMILES | CNC(=O)CC(CN)N1CCCc2ccccc21 |
| InChI | InChI=1S/C14H21N3O/c1-16-14(18)9-12(10-15)17-8-4-6-11-5-2-3-7-13(11)17/h2-3,5,7,12H,4,6,8-10,15H2,1H3,(H,16,18) |
| InChIKey | LJIBBLWZOIXLNI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |