C13H27N3OS — CID 66427409
4-amino-3-(2,6-dimethylthiomorpholin-4-yl)-N-propylbutanamide (PubChem CID 66427409) has the molecular formula C13H27N3OS and a molecular weight of 273.45 g/mol. Its IUPAC name is 4-amino-3-(2,6-dimethylthiomorpholin-4-yl)-N-propylbutanamide.
| Compound Name | 4-amino-3-(2,6-dimethylthiomorpholin-4-yl)-N-propylbutanamide |
|---|---|
| PubChem CID | 66427409 |
| Molecular Formula | C13H27N3OS |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 4-amino-3-(2,6-dimethylthiomorpholin-4-yl)-N-propylbutanamide |
| SMILES | CCCNC(=O)CC(CN)N1CC(C)SC(C)C1 |
| InChI | InChI=1S/C13H27N3OS/c1-4-5-15-13(17)6-12(7-14)16-8-10(2)18-11(3)9-16/h10-12H,4-9,14H2,1-3H3,(H,15,17) |
| InChIKey | GBITXWSJZMVALM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |