About 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide
4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide (PubChem CID 66427970) has the molecular formula C10H17N5O
and a molecular weight of 223.28 g/mol. Its IUPAC name is 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide.
Molecular Properties
| Compound Name | 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide |
| PubChem CID | 66427970 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide |
| SMILES | NCC(CC(N)=O)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C10H17N5O/c11-6-8(5-9(12)16)15-4-3-14-2-1-13-10(14)7-15/h1-2,8H,3-7,11H2,(H2,12,16) |
| InChIKey | FPEPVLQHXIIYHY-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide?
The IUPAC name of 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide (CID 66427970) is 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide.
What is the SMILES notation for 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide?
The canonical SMILES for 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide is NCC(CC(N)=O)N1CCn2ccnc2C1.
What is the InChIKey of 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide?
The InChIKey is FPEPVLQHXIIYHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O/c11-6-8(5-9(12)16)15-4-3-14-2-1-13-10(14)7-15/h1-2,8H,3-7,11H2,(H2,12,16).
What are the key properties of 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide?
4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide has a molecular weight of 223.28 g/mol, XLogP of -1.10, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)butanamide is sourced from PubChem (CID 66427970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).