C14H17FN2O4 — CID 66428476
methyl 4-fluoro-2-[(2-morpholin-2-ylacetyl)amino]benzoate (PubChem CID 66428476) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is methyl 4-fluoro-2-[(2-morpholin-2-ylacetyl)amino]benzoate.
| Compound Name | methyl 4-fluoro-2-[(2-morpholin-2-ylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 66428476 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | methyl 4-fluoro-2-[(2-morpholin-2-ylacetyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(F)cc1NC(=O)CC1CNCCO1 |
| InChI | InChI=1S/C14H17FN2O4/c1-20-14(19)11-3-2-9(15)6-12(11)17-13(18)7-10-8-16-4-5-21-10/h2-3,6,10,16H,4-5,7-8H2,1H3,(H,17,18) |
| InChIKey | ODXRPMFFHWIXJX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |