About 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide
2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide (PubChem CID 66429387) has the molecular formula C11H17N3O2S
and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide |
| PubChem CID | 66429387 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide |
| SMILES | O=C(CC1CNCCO1)NCCc1nccs1 |
| InChI | InChI=1S/C11H17N3O2S/c15-10(7-9-8-12-3-5-16-9)13-2-1-11-14-4-6-17-11/h4,6,9,12H,1-3,5,7-8H2,(H,13,15) |
| InChIKey | PHPKWVPIUUUMDQ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide?
The IUPAC name of 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide (CID 66429387) is 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide.
What is the SMILES notation for 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide?
The canonical SMILES for 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide is O=C(CC1CNCCO1)NCCc1nccs1.
What is the InChIKey of 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide?
The InChIKey is PHPKWVPIUUUMDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2S/c15-10(7-9-8-12-3-5-16-9)13-2-1-11-14-4-6-17-11/h4,6,9,12H,1-3,5,7-8H2,(H,13,15).
What are the key properties of 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide?
2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide has a molecular weight of 255.34 g/mol, XLogP of 0.18, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-2-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide is sourced from PubChem (CID 66429387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).