About 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile
2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile (PubChem CID 664308) has the molecular formula C16H17N3O4
and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile |
| PubChem CID | 664308 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile |
| SMILES | COc1ccc(-c2nc(C#N)c(N3CCOCC3)o2)cc1OC |
| InChI | InChI=1S/C16H17N3O4/c1-20-13-4-3-11(9-14(13)21-2)15-18-12(10-17)16(23-15)19-5-7-22-8-6-19/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | FCVKDGZDUJYPSH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile (CID 664308) is 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile is COc1ccc(-c2nc(C#N)c(N3CCOCC3)o2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile?
The InChIKey is FCVKDGZDUJYPSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O4/c1-20-13-4-3-11(9-14(13)21-2)15-18-12(10-17)16(23-15)19-5-7-22-8-6-19/h3-4,9H,5-8H2,1-2H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile?
2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile has a molecular weight of 315.33 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 664308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).