C13H15FN2O4 — CID 66433243
2-[4-(2-carbamoyl-4-fluorophenyl)morpholin-2-yl]acetic acid (PubChem CID 66433243) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 2-[4-(2-carbamoyl-4-fluorophenyl)morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-(2-carbamoyl-4-fluorophenyl)morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 66433243 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-[4-(2-carbamoyl-4-fluorophenyl)morpholin-2-yl]acetic acid |
| SMILES | NC(=O)c1cc(F)ccc1N1CCOC(CC(=O)O)C1 |
| InChI | InChI=1S/C13H15FN2O4/c14-8-1-2-11(10(5-8)13(15)19)16-3-4-20-9(7-16)6-12(17)18/h1-2,5,9H,3-4,6-7H2,(H2,15,19)(H,17,18) |
| InChIKey | PNEOAUMGYWCUJI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |