C12H20N2O6S — CID 66433295
2-[4-[(1,1-dioxothian-4-yl)carbamoyl]morpholin-2-yl]acetic acid (PubChem CID 66433295) has the molecular formula C12H20N2O6S and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-[4-[(1,1-dioxothian-4-yl)carbamoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[(1,1-dioxothian-4-yl)carbamoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 66433295 |
| Molecular Formula | C12H20N2O6S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-[4-[(1,1-dioxothian-4-yl)carbamoyl]morpholin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)NC2CCS(=O)(=O)CC2)CCO1 |
| InChI | InChI=1S/C12H20N2O6S/c15-11(16)7-10-8-14(3-4-20-10)12(17)13-9-1-5-21(18,19)6-2-9/h9-10H,1-8H2,(H,13,17)(H,15,16) |
| InChIKey | VXALHJZJPQIICW-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |