C10H14N4O2 — CID 66433370
N,N-bis(cyanomethyl)-2-morpholin-2-ylacetamide (PubChem CID 66433370) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2-morpholin-2-ylacetamide.
| Compound Name | N,N-bis(cyanomethyl)-2-morpholin-2-ylacetamide |
|---|---|
| PubChem CID | 66433370 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | N,N-bis(cyanomethyl)-2-morpholin-2-ylacetamide |
| SMILES | N#CCN(CC#N)C(=O)CC1CNCCO1 |
| InChI | InChI=1S/C10H14N4O2/c11-1-4-14(5-2-12)10(15)7-9-8-13-3-6-16-9/h9,13H,3-8H2 |
| InChIKey | HICGOCQQMBPGTG-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|