2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid

C8H11N3O3S — CID 66433440

IUPAC2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid
SMILESO=C(O)CC1CN(c2ncns2)CCO1
InChIInChI=1S/C8H11N3O3S/c12-7(13)3-6-4-11(1-2-14-6)8-9-5-10-15-8/h5-6H,1-4H2,(H,12,13)
InChIKeyGPRFIEFDSSZLNA-UHFFFAOYSA-N
MW229.26 g/mol
LogP0.22
Rot. Bonds3

About 2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid

2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid (PubChem CID 66433440) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid
PubChem CID66433440
Molecular FormulaC8H11N3O3S
Molecular Weight229.26 g/mol
Exact Mass229.05
IUPAC Name2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid
SMILESO=C(O)CC1CN(c2ncns2)CCO1
InChIInChI=1S/C8H11N3O3S/c12-7(13)3-6-4-11(1-2-14-6)8-9-5-10-15-8/h5-6H,1-4H2,(H,12,13)
InChIKeyGPRFIEFDSSZLNA-UHFFFAOYSA-N
XLogP0.22
TPSA75.55 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.26
LogP ≤ 50.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid?
The IUPAC name of 2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid (CID 66433440) is 2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid.
What is the SMILES notation for 2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid?
The canonical SMILES for 2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid is O=C(O)CC1CN(c2ncns2)CCO1.
What is the InChIKey of 2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid?
The InChIKey is GPRFIEFDSSZLNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3S/c12-7(13)3-6-4-11(1-2-14-6)8-9-5-10-15-8/h5-6H,1-4H2,(H,12,13).
What are the key properties of 2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid?
2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid has a molecular weight of 229.26 g/mol, XLogP of 0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetic acid is sourced from PubChem (CID 66433440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).