C12H19N3O5 — CID 66434305
2-[4-(5-oxo-1,4-diazepane-1-carbonyl)morpholin-2-yl]acetic acid (PubChem CID 66434305) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[4-(5-oxo-1,4-diazepane-1-carbonyl)morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-(5-oxo-1,4-diazepane-1-carbonyl)morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 66434305 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-[4-(5-oxo-1,4-diazepane-1-carbonyl)morpholin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)N2CCNC(=O)CC2)CCO1 |
| InChI | InChI=1S/C12H19N3O5/c16-10-1-3-14(4-2-13-10)12(19)15-5-6-20-9(8-15)7-11(17)18/h9H,1-8H2,(H,13,16)(H,17,18) |
| InChIKey | AWEOBIDECMNJNL-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |