About 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine
2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine (PubChem CID 66434955) has the molecular formula C12H16N4O
and a molecular weight of 232.29 g/mol. Its IUPAC name is 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine.
Molecular Properties
| Compound Name | 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine |
| PubChem CID | 66434955 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine |
| SMILES | Cn1c(CC2CNCCO2)nc2cnccc21 |
| InChI | InChI=1S/C12H16N4O/c1-16-11-2-3-13-8-10(11)15-12(16)6-9-7-14-4-5-17-9/h2-3,8-9,14H,4-7H2,1H3 |
| InChIKey | IPTHGAKSSKFNOJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine?
The IUPAC name of 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine (CID 66434955) is 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine.
What is the SMILES notation for 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine?
The canonical SMILES for 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine is Cn1c(CC2CNCCO2)nc2cnccc21.
What is the InChIKey of 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine?
The InChIKey is IPTHGAKSSKFNOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O/c1-16-11-2-3-13-8-10(11)15-12(16)6-9-7-14-4-5-17-9/h2-3,8-9,14H,4-7H2,1H3.
What are the key properties of 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine?
2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine has a molecular weight of 232.29 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-methylimidazo[4,5-c]pyridin-2-yl)methyl]morpholine is sourced from PubChem (CID 66434955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).