About methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate
methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate (PubChem CID 664364) has the molecular formula C21H29N3O4
and a molecular weight of 387.48 g/mol. Its IUPAC name is methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate |
| PubChem CID | 664364 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cccc(OC)c2c1NC(=O)CCN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C21H29N3O4/c1-13-10-14(2)12-24(11-13)9-8-17(25)23-19-18-15(6-5-7-16(18)27-3)22-20(19)21(26)28-4/h5-7,13-14,22H,8-12H2,1-4H3,(H,23,25) |
| InChIKey | YTHLYXPBUCXYRK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate?
The IUPAC name of methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate (CID 664364) is methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate.
What is the SMILES notation for methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate?
The canonical SMILES for methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate is COC(=O)c1[nH]c2cccc(OC)c2c1NC(=O)CCN1CC(C)CC(C)C1.
What is the InChIKey of methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate?
The InChIKey is YTHLYXPBUCXYRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N3O4/c1-13-10-14(2)12-24(11-13)9-8-17(25)23-19-18-15(6-5-7-16(18)27-3)22-20(19)21(26)28-4/h5-7,13-14,22H,8-12H2,1-4H3,(H,23,25).
What are the key properties of methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate?
methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate has a molecular weight of 387.48 g/mol, XLogP of 3.27, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3-(3,5-dimethylpiperidin-1-yl)propanoylamino]-4-methoxy-1H-indole-2-carboxylate is sourced from PubChem (CID 664364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).