C11H10N2O3S — CID 66437149
4-(2,6-dimethylpyrimidin-4-yl)oxythiophene-2-carboxylic acid (PubChem CID 66437149) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is 4-(2,6-dimethylpyrimidin-4-yl)oxythiophene-2-carboxylic acid.
| Compound Name | 4-(2,6-dimethylpyrimidin-4-yl)oxythiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 66437149 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 4-(2,6-dimethylpyrimidin-4-yl)oxythiophene-2-carboxylic acid |
| SMILES | Cc1cc(Oc2csc(C(=O)O)c2)nc(C)n1 |
| InChI | InChI=1S/C11H10N2O3S/c1-6-3-10(13-7(2)12-6)16-8-4-9(11(14)15)17-5-8/h3-5H,1-2H3,(H,14,15) |
| InChIKey | NUAIKTHVVTVOCA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |