About 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole
4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole (PubChem CID 664372) has the molecular formula C14H16N2S
and a molecular weight of 244.36 g/mol. Its IUPAC name is 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole.
Molecular Properties
| Compound Name | 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole |
| PubChem CID | 664372 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole |
| SMILES | CCc1ccc2c(c1)c1nc(C)sc1n2CC |
| InChI | InChI=1S/C14H16N2S/c1-4-10-6-7-12-11(8-10)13-14(16(12)5-2)17-9(3)15-13/h6-8H,4-5H2,1-3H3 |
| InChIKey | QHGDVAVJDUCAQO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole?
The IUPAC name of 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole (CID 664372) is 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole.
What is the SMILES notation for 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole?
The canonical SMILES for 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole is CCc1ccc2c(c1)c1nc(C)sc1n2CC.
What is the InChIKey of 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole?
The InChIKey is QHGDVAVJDUCAQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2S/c1-4-10-6-7-12-11(8-10)13-14(16(12)5-2)17-9(3)15-13/h6-8H,4-5H2,1-3H3.
What are the key properties of 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole?
4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole has a molecular weight of 244.36 g/mol, XLogP of 4.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-diethyl-2-methyl-[1,3]thiazolo[5,4-b]indole is sourced from PubChem (CID 664372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).