C10H17BrN2 — CID 66437945
4-(bromomethyl)-1,5-dipropylpyrazole (PubChem CID 66437945) has the molecular formula C10H17BrN2 and a molecular weight of 245.16 g/mol. Its IUPAC name is 4-(bromomethyl)-1,5-dipropylpyrazole.
| Compound Name | 4-(bromomethyl)-1,5-dipropylpyrazole |
|---|---|
| PubChem CID | 66437945 |
| Molecular Formula | C10H17BrN2 |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-(bromomethyl)-1,5-dipropylpyrazole |
| SMILES | CCCc1c(CBr)cnn1CCC |
| InChI | InChI=1S/C10H17BrN2/c1-3-5-10-9(7-11)8-12-13(10)6-4-2/h8H,3-7H2,1-2H3 |
| InChIKey | RUQWRLJOWAIDGS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|