C13H16F2N4 — CID 66439707
N-[[5-(difluoromethyl)-1-pyridin-4-ylpyrazol-4-yl]methyl]propan-1-amine (PubChem CID 66439707) has the molecular formula C13H16F2N4 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[[5-(difluoromethyl)-1-pyridin-4-ylpyrazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(difluoromethyl)-1-pyridin-4-ylpyrazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66439707 |
| Molecular Formula | C13H16F2N4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-[[5-(difluoromethyl)-1-pyridin-4-ylpyrazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnn(-c2ccncc2)c1C(F)F |
| InChI | InChI=1S/C13H16F2N4/c1-2-5-17-8-10-9-18-19(12(10)13(14)15)11-3-6-16-7-4-11/h3-4,6-7,9,13,17H,2,5,8H2,1H3 |
| InChIKey | GJNRTWRXHBZUCW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|