C13H18N4S2 — CID 664398
11-methyl-5-propan-2-ylsulfanyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 664398) has the molecular formula C13H18N4S2 and a molecular weight of 294.45 g/mol. Its IUPAC name is 11-methyl-5-propan-2-ylsulfanyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 11-methyl-5-propan-2-ylsulfanyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 664398 |
| Molecular Formula | C13H18N4S2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 11-methyl-5-propan-2-ylsulfanyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CC(C)Sc1nc(N)c2c3c(sc2n1)CN(C)CC3 |
| InChI | InChI=1S/C13H18N4S2/c1-7(2)18-13-15-11(14)10-8-4-5-17(3)6-9(8)19-12(10)16-13/h7H,4-6H2,1-3H3,(H2,14,15,16) |
| InChIKey | WJBRNAKBQJXEJW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |