C10H17F2N3 — CID 66440093
1-[5-(difluoromethyl)-1-(2-methylpropyl)pyrazol-4-yl]-N-methylmethanamine (PubChem CID 66440093) has the molecular formula C10H17F2N3 and a molecular weight of 217.26 g/mol. Its IUPAC name is 1-[5-(difluoromethyl)-1-(2-methylpropyl)pyrazol-4-yl]-N-methylmethanamine.
| Compound Name | 1-[5-(difluoromethyl)-1-(2-methylpropyl)pyrazol-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 66440093 |
| Molecular Formula | C10H17F2N3 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 1-[5-(difluoromethyl)-1-(2-methylpropyl)pyrazol-4-yl]-N-methylmethanamine |
| SMILES | CNCc1cnn(CC(C)C)c1C(F)F |
| InChI | InChI=1S/C10H17F2N3/c1-7(2)6-15-9(10(11)12)8(4-13-3)5-14-15/h5,7,10,13H,4,6H2,1-3H3 |
| InChIKey | SZDKCTKNMZASCN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |