C16H27F2N3 — CID 66440943
N-[[1-cycloheptyl-5-(difluoromethyl)pyrazol-4-yl]methyl]-2-methylpropan-1-amine (PubChem CID 66440943) has the molecular formula C16H27F2N3 and a molecular weight of 299.41 g/mol. Its IUPAC name is N-[[1-cycloheptyl-5-(difluoromethyl)pyrazol-4-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-cycloheptyl-5-(difluoromethyl)pyrazol-4-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 66440943 |
| Molecular Formula | C16H27F2N3 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | N-[[1-cycloheptyl-5-(difluoromethyl)pyrazol-4-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cnn(C2CCCCCC2)c1C(F)F |
| InChI | InChI=1S/C16H27F2N3/c1-12(2)9-19-10-13-11-20-21(15(13)16(17)18)14-7-5-3-4-6-8-14/h11-12,14,16,19H,3-10H2,1-2H3 |
| InChIKey | MFNBWURPUVMIRL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |