C12H11F4N3 — CID 66441478
1-[1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-N-methylmethanamine (PubChem CID 66441478) has the molecular formula C12H11F4N3 and a molecular weight of 273.23 g/mol. Its IUPAC name is 1-[1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-N-methylmethanamine.
| Compound Name | 1-[1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 66441478 |
| Molecular Formula | C12H11F4N3 |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 1-[1-(2-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-N-methylmethanamine |
| SMILES | CNCc1cnn(-c2ccccc2F)c1C(F)(F)F |
| InChI | InChI=1S/C12H11F4N3/c1-17-6-8-7-18-19(11(8)12(14,15)16)10-5-3-2-4-9(10)13/h2-5,7,17H,6H2,1H3 |
| InChIKey | TYCZBWPMSPVBJE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |