C9H15NO3S2 — CID 66443082
2-[4-(2-methylsulfanylacetyl)thiomorpholin-3-yl]acetic acid (PubChem CID 66443082) has the molecular formula C9H15NO3S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-[4-(2-methylsulfanylacetyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(2-methylsulfanylacetyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66443082 |
| Molecular Formula | C9H15NO3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2-[4-(2-methylsulfanylacetyl)thiomorpholin-3-yl]acetic acid |
| SMILES | CSCC(=O)N1CCSCC1CC(=O)O |
| InChI | InChI=1S/C9H15NO3S2/c1-14-6-8(11)10-2-3-15-5-7(10)4-9(12)13/h7H,2-6H2,1H3,(H,12,13) |
| InChIKey | MIXNBQRVIVVGAA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |