C33H25Cl2FN2O5 — CID 6644385
(3aS,6R,6aS,9aR,10aS,10bR)-2-benzyl-6a,9a-dichloro-8-(4-fluorophenyl)-6-(3-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6644385) has the molecular formula C33H25Cl2FN2O5 and a molecular weight of 619.48 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,10aS,10bR)-2-benzyl-6a,9a-dichloro-8-(4-fluorophenyl)-6-(3-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6R,6aS,9aR,10aS,10bR)-2-benzyl-6a,9a-dichloro-8-(4-fluorophenyl)-6-(3-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6644385 |
| Molecular Formula | C33H25Cl2FN2O5 |
| Molecular Weight | 619.48 g/mol |
| Exact Mass | 618.11 |
| IUPAC Name | (3aS,6R,6aS,9aR,10aS,10bR)-2-benzyl-6a,9a-dichloro-8-(4-fluorophenyl)-6-(3-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1[C@H]2[C@H](CC=C3[C@H]2C[C@@]2(Cl)C(=O)N(c4ccc(F)cc4)C(=O)[C@@]2(Cl)[C@H]3c2cccc(O)c2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C33H25Cl2FN2O5/c34-32-16-25-23(13-14-24-26(25)29(41)37(28(24)40)17-18-5-2-1-3-6-18)27(19-7-4-8-22(39)15-19)33(32,35)31(43)38(30(32)42)21-11-9-20(36)10-12-21/h1-13,15,24-27,39H,14,16-17H2/t24-,25+,26-,27-,32+,33-/m0/s1 |
| InChIKey | QCTVHLAIYIQJET-NQTDQUNXSA-N |
| XLogP | 5.29 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|