About 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine
3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine (PubChem CID 66445237) has the molecular formula C14H19N3O2S
and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine.
Molecular Properties
| Compound Name | 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine |
| PubChem CID | 66445237 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine |
| SMILES | COc1cc2nc(CC3CSCCN3)[nH]c2cc1OC |
| InChI | InChI=1S/C14H19N3O2S/c1-18-12-6-10-11(7-13(12)19-2)17-14(16-10)5-9-8-20-4-3-15-9/h6-7,9,15H,3-5,8H2,1-2H3,(H,16,17) |
| InChIKey | NAWFODTZLCMVIV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine?
The IUPAC name of 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine (CID 66445237) is 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine.
What is the SMILES notation for 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine?
The canonical SMILES for 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine is COc1cc2nc(CC3CSCCN3)[nH]c2cc1OC.
What is the InChIKey of 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine?
The InChIKey is NAWFODTZLCMVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2S/c1-18-12-6-10-11(7-13(12)19-2)17-14(16-10)5-9-8-20-4-3-15-9/h6-7,9,15H,3-5,8H2,1-2H3,(H,16,17).
What are the key properties of 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine?
3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine has a molecular weight of 293.39 g/mol, XLogP of 1.83, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]thiomorpholine is sourced from PubChem (CID 66445237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).