C13H12F3N3OS — CID 66445248
5-(thiomorpholin-3-ylmethyl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole (PubChem CID 66445248) has the molecular formula C13H12F3N3OS and a molecular weight of 315.32 g/mol. Its IUPAC name is 5-(thiomorpholin-3-ylmethyl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(thiomorpholin-3-ylmethyl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 66445248 |
| Molecular Formula | C13H12F3N3OS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-(thiomorpholin-3-ylmethyl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole |
| SMILES | Fc1cc(-c2noc(CC3CSCCN3)n2)cc(F)c1F |
| InChI | InChI=1S/C13H12F3N3OS/c14-9-3-7(4-10(15)12(9)16)13-18-11(20-19-13)5-8-6-21-2-1-17-8/h3-4,8,17H,1-2,5-6H2 |
| InChIKey | IWZYXXBLJHSEHO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|