About 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone
2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone (PubChem CID 664458) has the molecular formula C16H10N2O2S2
and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone.
Molecular Properties
| Compound Name | 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone |
| PubChem CID | 664458 |
| Molecular Formula | C16H10N2O2S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone |
| SMILES | O=C(CSc1ncnc2c1oc1ccccc12)c1cccs1 |
| InChI | InChI=1S/C16H10N2O2S2/c19-11(13-6-3-7-21-13)8-22-16-15-14(17-9-18-16)10-4-1-2-5-12(10)20-15/h1-7,9H,8H2 |
| InChIKey | OFQHSVSIMICVEF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone?
The IUPAC name of 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone (CID 664458) is 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone.
What is the SMILES notation for 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone?
The canonical SMILES for 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone is O=C(CSc1ncnc2c1oc1ccccc12)c1cccs1.
What is the InChIKey of 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone?
The InChIKey is OFQHSVSIMICVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O2S2/c19-11(13-6-3-7-21-13)8-22-16-15-14(17-9-18-16)10-4-1-2-5-12(10)20-15/h1-7,9H,8H2.
What are the key properties of 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone?
2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone has a molecular weight of 326.40 g/mol, XLogP of 4.41, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-thiophen-2-ylethanone is sourced from PubChem (CID 664458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).