C17H17NO — CID 66446406
1-(2,3-dihydro-1H-inden-5-yl)-2-pyridin-2-ylpropan-1-one (PubChem CID 66446406) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-pyridin-2-ylpropan-1-one.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-pyridin-2-ylpropan-1-one |
|---|---|
| PubChem CID | 66446406 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-pyridin-2-ylpropan-1-one |
| SMILES | CC(C(=O)c1ccc2c(c1)CCC2)c1ccccn1 |
| InChI | InChI=1S/C17H17NO/c1-12(16-7-2-3-10-18-16)17(19)15-9-8-13-5-4-6-14(13)11-15/h2-3,7-12H,4-6H2,1H3 |
| InChIKey | BLHLBCSESPFNLH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |