C16H20N2O2 — CID 66446566
1-(2,6-dimethoxyphenyl)-2-pyridin-4-ylpropan-1-amine (PubChem CID 66446566) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-2-pyridin-4-ylpropan-1-amine.
| Compound Name | 1-(2,6-dimethoxyphenyl)-2-pyridin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 66446566 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-2-pyridin-4-ylpropan-1-amine |
| SMILES | COc1cccc(OC)c1C(N)C(C)c1ccncc1 |
| InChI | InChI=1S/C16H20N2O2/c1-11(12-7-9-18-10-8-12)16(17)15-13(19-2)5-4-6-14(15)20-3/h4-11,16H,17H2,1-3H3 |
| InChIKey | HSJQTKQILDADPX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |