C16H18F2N2 — CID 66447218
1-(2,3-difluorophenyl)-N-ethyl-2-pyridin-2-ylpropan-1-amine (PubChem CID 66447218) has the molecular formula C16H18F2N2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-N-ethyl-2-pyridin-2-ylpropan-1-amine.
| Compound Name | 1-(2,3-difluorophenyl)-N-ethyl-2-pyridin-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 66447218 |
| Molecular Formula | C16H18F2N2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-(2,3-difluorophenyl)-N-ethyl-2-pyridin-2-ylpropan-1-amine |
| SMILES | CCNC(c1cccc(F)c1F)C(C)c1ccccn1 |
| InChI | InChI=1S/C16H18F2N2/c1-3-19-16(11(2)14-9-4-5-10-20-14)12-7-6-8-13(17)15(12)18/h4-11,16,19H,3H2,1-2H3 |
| InChIKey | KIFVKTRLBDSAMJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |