C18H30N2 — CID 66447669
1-cyclooctyl-N-ethyl-2-(3-methyl-2-pyridinyl)ethanamine (PubChem CID 66447669) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-cyclooctyl-N-ethyl-2-(3-methyl-2-pyridinyl)ethanamine.
| Compound Name | 1-cyclooctyl-N-ethyl-2-(3-methyl-2-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 66447669 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 1-cyclooctyl-N-ethyl-2-(3-methyl-2-pyridinyl)ethanamine |
| SMILES | CCNC(Cc1ncccc1C)C1CCCCCCC1 |
| InChI | InChI=1S/C18H30N2/c1-3-19-18(14-17-15(2)10-9-13-20-17)16-11-7-5-4-6-8-12-16/h9-10,13,16,18-19H,3-8,11-12,14H2,1-2H3 |
| InChIKey | ZCCOBUSWIZVABW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |