C17H18N4O2 — CID 664488
1-(2-benzyl-4-cyano-1,3-oxazol-5-yl)piperidine-4-carboxamide (PubChem CID 664488) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-(2-benzyl-4-cyano-1,3-oxazol-5-yl)piperidine-4-carboxamide.
| Compound Name | 1-(2-benzyl-4-cyano-1,3-oxazol-5-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 664488 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-(2-benzyl-4-cyano-1,3-oxazol-5-yl)piperidine-4-carboxamide |
| SMILES | N#Cc1nc(Cc2ccccc2)oc1N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H18N4O2/c18-11-14-17(21-8-6-13(7-9-21)16(19)22)23-15(20-14)10-12-4-2-1-3-5-12/h1-5,13H,6-10H2,(H2,19,22) |
| InChIKey | CNXYPSNKHAGEBP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |