C9H11F4N3O — CID 66449613
N-methyl-1-[6-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methanamine (PubChem CID 66449613) has the molecular formula C9H11F4N3O and a molecular weight of 253.20 g/mol. Its IUPAC name is N-methyl-1-[6-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methanamine.
| Compound Name | N-methyl-1-[6-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methanamine |
|---|---|
| PubChem CID | 66449613 |
| Molecular Formula | C9H11F4N3O |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | N-methyl-1-[6-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methanamine |
| SMILES | CNCc1cncc(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C9H11F4N3O/c1-14-2-6-3-15-4-7(16-6)17-5-9(12,13)8(10)11/h3-4,8,14H,2,5H2,1H3 |
| InChIKey | PXPGEWYMACHSBC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|