C11H15F4N3O — CID 66449812
N-[[6-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methyl]propan-1-amine (PubChem CID 66449812) has the molecular formula C11H15F4N3O and a molecular weight of 281.25 g/mol. Its IUPAC name is N-[[6-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[6-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66449812 |
| Molecular Formula | C11H15F4N3O |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-[[6-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cncc(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C11H15F4N3O/c1-2-3-16-4-8-5-17-6-9(18-8)19-7-11(14,15)10(12)13/h5-6,10,16H,2-4,7H2,1H3 |
| InChIKey | QFJIQUWMPUQMOL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|