About methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate
methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate (PubChem CID 66450284) has the molecular formula C10H12F3N3O2
and a molecular weight of 263.22 g/mol. Its IUPAC name is methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate |
| PubChem CID | 66450284 |
| Molecular Formula | C10H12F3N3O2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate |
| SMILES | CCN(CC(F)(F)F)c1cncc(C(=O)OC)n1 |
| InChI | InChI=1S/C10H12F3N3O2/c1-3-16(6-10(11,12)13)8-5-14-4-7(15-8)9(17)18-2/h4-5H,3,6H2,1-2H3 |
| InChIKey | VYCKPDNUNOROIV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate?
The IUPAC name of methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate (CID 66450284) is methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate?
The canonical SMILES for methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate is CCN(CC(F)(F)F)c1cncc(C(=O)OC)n1.
What is the InChIKey of methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate?
The InChIKey is VYCKPDNUNOROIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F3N3O2/c1-3-16(6-10(11,12)13)8-5-14-4-7(15-8)9(17)18-2/h4-5H,3,6H2,1-2H3.
What are the key properties of methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate?
methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate has a molecular weight of 263.22 g/mol, XLogP of 1.65, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[ethyl(2,2,2-trifluoroethyl)amino]pyrazine-2-carboxylate is sourced from PubChem (CID 66450284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).