C14H23N3O2 — CID 66450584
N-[[6-(oxan-2-ylmethoxy)pyrazin-2-yl]methyl]propan-2-amine (PubChem CID 66450584) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is N-[[6-(oxan-2-ylmethoxy)pyrazin-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[6-(oxan-2-ylmethoxy)pyrazin-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66450584 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-[[6-(oxan-2-ylmethoxy)pyrazin-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cncc(OCC2CCCCO2)n1 |
| InChI | InChI=1S/C14H23N3O2/c1-11(2)16-8-12-7-15-9-14(17-12)19-10-13-5-3-4-6-18-13/h7,9,11,13,16H,3-6,8,10H2,1-2H3 |
| InChIKey | OTMLIPSNPZSBPG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |