About 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol
4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol (PubChem CID 66453390) has the molecular formula C15H26N2O
and a molecular weight of 250.39 g/mol. Its IUPAC name is 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol.
Molecular Properties
| Compound Name | 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol |
| PubChem CID | 66453390 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol |
| SMILES | CCNC(C)C(C)(C)CN(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H26N2O/c1-6-16-12(2)15(3,4)11-17(5)13-7-9-14(18)10-8-13/h7-10,12,16,18H,6,11H2,1-5H3 |
| InChIKey | HOWDYGBVCRRPJQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol?
The IUPAC name of 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol (CID 66453390) is 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol.
What is the SMILES notation for 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol?
The canonical SMILES for 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol is CCNC(C)C(C)(C)CN(C)c1ccc(O)cc1.
What is the InChIKey of 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol?
The InChIKey is HOWDYGBVCRRPJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O/c1-6-16-12(2)15(3,4)11-17(5)13-7-9-14(18)10-8-13/h7-10,12,16,18H,6,11H2,1-5H3.
What are the key properties of 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol?
4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol has a molecular weight of 250.39 g/mol, XLogP of 2.85, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(ethylamino)-2,2-dimethylbutyl]-methylamino]phenol is sourced from PubChem (CID 66453390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).