C16H16BrN — CID 66453780
2-[1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-bromopropan-2-yl]pyridine (PubChem CID 66453780) has the molecular formula C16H16BrN and a molecular weight of 302.22 g/mol. Its IUPAC name is 2-[1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-bromopropan-2-yl]pyridine.
| Compound Name | 2-[1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-bromopropan-2-yl]pyridine |
|---|---|
| PubChem CID | 66453780 |
| Molecular Formula | C16H16BrN |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-[1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-bromopropan-2-yl]pyridine |
| SMILES | CC(c1ccccn1)C(Br)C1Cc2ccccc21 |
| InChI | InChI=1S/C16H16BrN/c1-11(15-8-4-5-9-18-15)16(17)14-10-12-6-2-3-7-13(12)14/h2-9,11,14,16H,10H2,1H3 |
| InChIKey | IXRXDLIEVIVSTH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|