C16H18BrN — CID 66454426
2-[1-bromo-1-(2,5-dimethylphenyl)propan-2-yl]pyridine (PubChem CID 66454426) has the molecular formula C16H18BrN and a molecular weight of 304.23 g/mol. Its IUPAC name is 2-[1-bromo-1-(2,5-dimethylphenyl)propan-2-yl]pyridine.
| Compound Name | 2-[1-bromo-1-(2,5-dimethylphenyl)propan-2-yl]pyridine |
|---|---|
| PubChem CID | 66454426 |
| Molecular Formula | C16H18BrN |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-[1-bromo-1-(2,5-dimethylphenyl)propan-2-yl]pyridine |
| SMILES | Cc1ccc(C)c(C(Br)C(C)c2ccccn2)c1 |
| InChI | InChI=1S/C16H18BrN/c1-11-7-8-12(2)14(10-11)16(17)13(3)15-6-4-5-9-18-15/h4-10,13,16H,1-3H3 |
| InChIKey | SUYFVSDWSZEAHU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|