About 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol
2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol (PubChem CID 66455172) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol |
| PubChem CID | 66455172 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol |
| SMILES | CNC(C)C(C)(C)CN(CCO)C1CC1 |
| InChI | InChI=1S/C12H26N2O/c1-10(13-4)12(2,3)9-14(7-8-15)11-5-6-11/h10-11,13,15H,5-9H2,1-4H3 |
| InChIKey | BIKKISZBLOERIB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol?
The IUPAC name of 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol (CID 66455172) is 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol.
What is the SMILES notation for 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol?
The canonical SMILES for 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol is CNC(C)C(C)(C)CN(CCO)C1CC1.
What is the InChIKey of 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol?
The InChIKey is BIKKISZBLOERIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-10(13-4)12(2,3)9-14(7-8-15)11-5-6-11/h10-11,13,15H,5-9H2,1-4H3.
What are the key properties of 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol?
2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol has a molecular weight of 214.35 g/mol, XLogP of 1.08, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopropyl-[2,2-dimethyl-3-(methylamino)butyl]amino]ethanol is sourced from PubChem (CID 66455172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).