About methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate
methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate (PubChem CID 66456495) has the molecular formula C10H12N6O2
and a molecular weight of 248.25 g/mol. Its IUPAC name is methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate |
| PubChem CID | 66456495 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NCc2nncn2C)n1 |
| InChI | InChI=1S/C10H12N6O2/c1-16-6-13-15-9(16)5-12-8-4-11-3-7(14-8)10(17)18-2/h3-4,6H,5H2,1-2H3,(H,12,14) |
| InChIKey | KXLJKAOOAZEEBD-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate?
The IUPAC name of methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate (CID 66456495) is methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate?
The canonical SMILES for methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate is COC(=O)c1cncc(NCc2nncn2C)n1.
What is the InChIKey of methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate?
The InChIKey is KXLJKAOOAZEEBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N6O2/c1-16-6-13-15-9(16)5-12-8-4-11-3-7(14-8)10(17)18-2/h3-4,6H,5H2,1-2H3,(H,12,14).
What are the key properties of methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate?
methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate has a molecular weight of 248.25 g/mol, XLogP of 0.00, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pyrazine-2-carboxylate is sourced from PubChem (CID 66456495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).