C13H23N5 — CID 66456780
N-methyl-1-[6-(4-propylpiperazin-1-yl)pyrazin-2-yl]methanamine (PubChem CID 66456780) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is N-methyl-1-[6-(4-propylpiperazin-1-yl)pyrazin-2-yl]methanamine.
| Compound Name | N-methyl-1-[6-(4-propylpiperazin-1-yl)pyrazin-2-yl]methanamine |
|---|---|
| PubChem CID | 66456780 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | N-methyl-1-[6-(4-propylpiperazin-1-yl)pyrazin-2-yl]methanamine |
| SMILES | CCCN1CCN(c2cncc(CNC)n2)CC1 |
| InChI | InChI=1S/C13H23N5/c1-3-4-17-5-7-18(8-6-17)13-11-15-10-12(16-13)9-14-2/h10-11,14H,3-9H2,1-2H3 |
| InChIKey | OXWRRQICTJTNIC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |