C15H24N4 — CID 66456808
N-cyclopentyl-6-[(cyclopropylamino)methyl]-N-ethylpyrazin-2-amine (PubChem CID 66456808) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is N-cyclopentyl-6-[(cyclopropylamino)methyl]-N-ethylpyrazin-2-amine.
| Compound Name | N-cyclopentyl-6-[(cyclopropylamino)methyl]-N-ethylpyrazin-2-amine |
|---|---|
| PubChem CID | 66456808 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | N-cyclopentyl-6-[(cyclopropylamino)methyl]-N-ethylpyrazin-2-amine |
| SMILES | CCN(c1cncc(CNC2CC2)n1)C1CCCC1 |
| InChI | InChI=1S/C15H24N4/c1-2-19(14-5-3-4-6-14)15-11-16-9-13(18-15)10-17-12-7-8-12/h9,11-12,14,17H,2-8,10H2,1H3 |
| InChIKey | XNZRVUFIXDJLCC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |