C14H11ClF3N — CID 66460615
2-[1-chloro-1-(2,4,6-trifluorophenyl)propan-2-yl]pyridine (PubChem CID 66460615) has the molecular formula C14H11ClF3N and a molecular weight of 285.70 g/mol. Its IUPAC name is 2-[1-chloro-1-(2,4,6-trifluorophenyl)propan-2-yl]pyridine.
| Compound Name | 2-[1-chloro-1-(2,4,6-trifluorophenyl)propan-2-yl]pyridine |
|---|---|
| PubChem CID | 66460615 |
| Molecular Formula | C14H11ClF3N |
| Molecular Weight | 285.70 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-[1-chloro-1-(2,4,6-trifluorophenyl)propan-2-yl]pyridine |
| SMILES | CC(c1ccccn1)C(Cl)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H11ClF3N/c1-8(12-4-2-3-5-19-12)14(15)13-10(17)6-9(16)7-11(13)18/h2-8,14H,1H3 |
| InChIKey | SPMBXVZRGWDOIQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|