C14H9ClF5N — CID 66460997
2-[2-chloro-2-(2,3,4,5,6-pentafluorophenyl)ethyl]-3-methylpyridine (PubChem CID 66460997) has the molecular formula C14H9ClF5N and a molecular weight of 321.68 g/mol. Its IUPAC name is 2-[2-chloro-2-(2,3,4,5,6-pentafluorophenyl)ethyl]-3-methylpyridine.
| Compound Name | 2-[2-chloro-2-(2,3,4,5,6-pentafluorophenyl)ethyl]-3-methylpyridine |
|---|---|
| PubChem CID | 66460997 |
| Molecular Formula | C14H9ClF5N |
| Molecular Weight | 321.68 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2-[2-chloro-2-(2,3,4,5,6-pentafluorophenyl)ethyl]-3-methylpyridine |
| SMILES | Cc1cccnc1CC(Cl)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H9ClF5N/c1-6-3-2-4-21-8(6)5-7(15)9-10(16)12(18)14(20)13(19)11(9)17/h2-4,7H,5H2,1H3 |
| InChIKey | NQZBXJNUCHZLPX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|