C13H9BrClNOS — CID 66461342
2-[2-(3-bromothiophen-2-yl)-2-chloroethyl]-1,3-benzoxazole (PubChem CID 66461342) has the molecular formula C13H9BrClNOS and a molecular weight of 342.65 g/mol. Its IUPAC name is 2-[2-(3-bromothiophen-2-yl)-2-chloroethyl]-1,3-benzoxazole.
| Compound Name | 2-[2-(3-bromothiophen-2-yl)-2-chloroethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 66461342 |
| Molecular Formula | C13H9BrClNOS |
| Molecular Weight | 342.65 g/mol |
| Exact Mass | 340.93 |
| IUPAC Name | 2-[2-(3-bromothiophen-2-yl)-2-chloroethyl]-1,3-benzoxazole |
| SMILES | ClC(Cc1nc2ccccc2o1)c1sccc1Br |
| InChI | InChI=1S/C13H9BrClNOS/c14-8-5-6-18-13(8)9(15)7-12-16-10-3-1-2-4-11(10)17-12/h1-6,9H,7H2 |
| InChIKey | AXDYBDWLAJYLJD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|