C19H18BrN — CID 66461439
2-[2-bromo-2-(3,5-dimethylphenyl)ethyl]quinoline (PubChem CID 66461439) has the molecular formula C19H18BrN and a molecular weight of 340.26 g/mol. Its IUPAC name is 2-[2-bromo-2-(3,5-dimethylphenyl)ethyl]quinoline.
| Compound Name | 2-[2-bromo-2-(3,5-dimethylphenyl)ethyl]quinoline |
|---|---|
| PubChem CID | 66461439 |
| Molecular Formula | C19H18BrN |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-[2-bromo-2-(3,5-dimethylphenyl)ethyl]quinoline |
| SMILES | Cc1cc(C)cc(C(Br)Cc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C19H18BrN/c1-13-9-14(2)11-16(10-13)18(20)12-17-8-7-15-5-3-4-6-19(15)21-17/h3-11,18H,12H2,1-2H3 |
| InChIKey | ZMPAAXKGFBCUGP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|